C10H8Cl2 — CID 159942937
1-chloro-2-(1-chlorobuta-1,2-dienyl)benzene (PubChem CID 159942937) has the molecular formula C10H8Cl2 and a molecular weight of 199.08 g/mol. Its IUPAC name is 1-chloro-2-(1-chlorobuta-1,2-dienyl)benzene.
| Compound Name | 1-chloro-2-(1-chlorobuta-1,2-dienyl)benzene |
|---|---|
| PubChem CID | 159942937 |
| Molecular Formula | C10H8Cl2 |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 1-chloro-2-(1-chlorobuta-1,2-dienyl)benzene |
| SMILES | CC=C=C(Cl)c1ccccc1Cl |
| InChI | InChI=1S/C10H8Cl2/c1-2-5-9(11)8-6-3-4-7-10(8)12/h2-4,6-7H,1H3 |
| InChIKey | OBCSRESGLUCDBG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |