C8H4Cl4 — CID 54482380
1-chloro-2-(1,2,2-trichloroethenyl)benzene (PubChem CID 54482380) has the molecular formula C8H4Cl4 and a molecular weight of 241.93 g/mol. Its IUPAC name is 1-chloro-2-(1,2,2-trichloroethenyl)benzene.
| Compound Name | 1-chloro-2-(1,2,2-trichloroethenyl)benzene |
|---|---|
| PubChem CID | 54482380 |
| Molecular Formula | C8H4Cl4 |
| Molecular Weight | 241.93 g/mol |
| Exact Mass | 239.91 |
| IUPAC Name | 1-chloro-2-(1,2,2-trichloroethenyl)benzene |
| SMILES | ClC(Cl)=C(Cl)c1ccccc1Cl |
| InChI | InChI=1S/C8H4Cl4/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4H |
| InChIKey | XPXMCUKPGZUFGR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |