C8H5Cl3O2 — CID 155490176
3-(1,2,2-trichloroethenyl)benzene-1,2-diol (PubChem CID 155490176) has the molecular formula C8H5Cl3O2 and a molecular weight of 239.49 g/mol. Its IUPAC name is 3-(1,2,2-trichloroethenyl)benzene-1,2-diol.
| Compound Name | 3-(1,2,2-trichloroethenyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 155490176 |
| Molecular Formula | C8H5Cl3O2 |
| Molecular Weight | 239.49 g/mol |
| Exact Mass | 237.94 |
| IUPAC Name | 3-(1,2,2-trichloroethenyl)benzene-1,2-diol |
| SMILES | Oc1cccc(C(Cl)=C(Cl)Cl)c1O |
| InChI | InChI=1S/C8H5Cl3O2/c9-6(8(10)11)4-2-1-3-5(12)7(4)13/h1-3,12-13H |
| InChIKey | FIUKUFAWBLUYOF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|