C12H11ClO — CID 102125928
5-(2-chlorophenyl)hexa-3,4-dien-2-one (PubChem CID 102125928) has the molecular formula C12H11ClO and a molecular weight of 206.67 g/mol. Its IUPAC name is 5-(2-chlorophenyl)hexa-3,4-dien-2-one.
| Compound Name | 5-(2-chlorophenyl)hexa-3,4-dien-2-one |
|---|---|
| PubChem CID | 102125928 |
| Molecular Formula | C12H11ClO |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 5-(2-chlorophenyl)hexa-3,4-dien-2-one |
| SMILES | CC(=O)C=C=C(C)c1ccccc1Cl |
| InChI | InChI=1S/C12H11ClO/c1-9(7-8-10(2)14)11-5-3-4-6-12(11)13/h3-6,8H,1-2H3 |
| InChIKey | CMZNYFWHRSJQJX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|