C10H7ClO — CID 10583489
1-(2-chlorophenyl)buta-2,3-dien-1-one (PubChem CID 10583489) has the molecular formula C10H7ClO and a molecular weight of 178.62 g/mol. Its IUPAC name is 1-(2-chlorophenyl)buta-2,3-dien-1-one.
| Compound Name | 1-(2-chlorophenyl)buta-2,3-dien-1-one |
|---|---|
| PubChem CID | 10583489 |
| Molecular Formula | C10H7ClO |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 1-(2-chlorophenyl)buta-2,3-dien-1-one |
| SMILES | C=C=CC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C10H7ClO/c1-2-5-10(12)8-6-3-4-7-9(8)11/h3-7H,1H2 |
| InChIKey | CNUGJGGIIBASLS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|