C24H22N2 — CID 138636529
N'-[(1Z)-3-methyl-1-(2-phenylphenyl)buta-1,3-dienyl]benzenecarboximidamide (PubChem CID 138636529) has the molecular formula C24H22N2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N'-[(1Z)-3-methyl-1-(2-phenylphenyl)buta-1,3-dienyl]benzenecarboximidamide.
| Compound Name | N'-[(1Z)-3-methyl-1-(2-phenylphenyl)buta-1,3-dienyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 138636529 |
| Molecular Formula | C24H22N2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N'-[(1Z)-3-methyl-1-(2-phenylphenyl)buta-1,3-dienyl]benzenecarboximidamide |
| SMILES | C=C(C)/C=C(\N=C(/N)c1ccccc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H22N2/c1-18(2)17-23(26-24(25)20-13-7-4-8-14-20)22-16-10-9-15-21(22)19-11-5-3-6-12-19/h3-17H,1H2,2H3,(H2,25,26)/b23-17- |
| InChIKey | ONIHAGZUAVGGOF-QJOMJCCJSA-N |
| XLogP | 5.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|