C22H18 — CID 139038108
1-phenyl-2-[(1Z)-1-phenylbuta-1,3-dienyl]benzene (PubChem CID 139038108) has the molecular formula C22H18 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-phenyl-2-[(1Z)-1-phenylbuta-1,3-dienyl]benzene.
| Compound Name | 1-phenyl-2-[(1Z)-1-phenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 139038108 |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-phenyl-2-[(1Z)-1-phenylbuta-1,3-dienyl]benzene |
| SMILES | C=C/C=C(/c1ccccc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H18/c1-2-11-20(18-12-5-3-6-13-18)22-17-10-9-16-21(22)19-14-7-4-8-15-19/h2-17H,1H2/b20-11- |
| InChIKey | BVVXXSDLVVWEBG-JAIQZWGSSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|