C10H10S — CID 11193677
(1Z)-1-phenylbuta-1,3-diene-1-thiol (PubChem CID 11193677) has the molecular formula C10H10S and a molecular weight of 162.26 g/mol. Its IUPAC name is (1Z)-1-phenylbuta-1,3-diene-1-thiol.
| Compound Name | (1Z)-1-phenylbuta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 11193677 |
| Molecular Formula | C10H10S |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (1Z)-1-phenylbuta-1,3-diene-1-thiol |
| SMILES | C=C/C=C(\S)c1ccccc1 |
| InChI | InChI=1S/C10H10S/c1-2-6-10(11)9-7-4-3-5-8-9/h2-8,11H,1H2/b10-6- |
| InChIKey | YEAAMYFSJCHPQV-POHAHGRESA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|