C11H11N — CID 142314562
N-[(1Z)-1-phenylbuta-1,3-dienyl]methanimine (PubChem CID 142314562) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is N-[(1Z)-1-phenylbuta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z)-1-phenylbuta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 142314562 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N-[(1Z)-1-phenylbuta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(\N=C)c1ccccc1 |
| InChI | InChI=1S/C11H11N/c1-3-7-11(12-2)10-8-5-4-6-9-10/h3-9H,1-2H2/b11-7- |
| InChIKey | QLTKACDXTIDHTK-XFFZJAGNSA-N |
| XLogP | 2.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|