About N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline
N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline (PubChem CID 143181239) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline.
Molecular Properties
| Compound Name | N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline |
| PubChem CID | 143181239 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline |
| SMILES | C=C/C=C(\N=C)c1cccc(NC(C)(C)C)c1 |
| InChI | InChI=1S/C15H20N2/c1-6-8-14(16-5)12-9-7-10-13(11-12)17-15(2,3)4/h6-11,17H,1,5H2,2-4H3/b14-8- |
| InChIKey | PNCORSPCEAMESK-ZSOIEALJSA-N |
| XLogP | 4.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline?
The IUPAC name of N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline (CID 143181239) is N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline.
What is the SMILES notation for N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline?
The canonical SMILES for N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline is C=C/C=C(\N=C)c1cccc(NC(C)(C)C)c1.
What is the InChIKey of N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline?
The InChIKey is PNCORSPCEAMESK-ZSOIEALJSA-N. The full InChI is InChI=1S/C15H20N2/c1-6-8-14(16-5)12-9-7-10-13(11-12)17-15(2,3)4/h6-11,17H,1,5H2,2-4H3/b14-8-.
What are the key properties of N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline?
N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline has a molecular weight of 228.34 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]aniline is sourced from PubChem (CID 143181239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).