C13H14N2O2 — CID 156753613
methyl 3-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]benzoate (PubChem CID 156753613) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is methyl 3-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]benzoate.
| Compound Name | methyl 3-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]benzoate |
|---|---|
| PubChem CID | 156753613 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | methyl 3-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]benzoate |
| SMILES | C=C/C=C(\N=C)Nc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C13H14N2O2/c1-4-6-12(14-2)15-11-8-5-7-10(9-11)13(16)17-3/h4-9,15H,1-2H2,3H3/b12-6+ |
| InChIKey | KMGQMEKYOJNMED-WUXMJOGZSA-N |
| XLogP | 2.61 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|