C12H12N2O2 — CID 156753695
3-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]benzoic acid (PubChem CID 156753695) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]benzoic acid.
| Compound Name | 3-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]benzoic acid |
|---|---|
| PubChem CID | 156753695 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]benzoic acid |
| SMILES | C=C/C=C(\N=C)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C12H12N2O2/c1-3-5-11(13-2)14-10-7-4-6-9(8-10)12(15)16/h3-8,14H,1-2H2,(H,15,16)/b11-5+ |
| InChIKey | CTIMCMPJXWESNH-VZUCSPMQSA-N |
| XLogP | 2.52 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|