C12H14O — CID 10487466
[(1E)-1-ethoxybuta-1,3-dienyl]benzene (PubChem CID 10487466) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is [(1E)-1-ethoxybuta-1,3-dienyl]benzene.
| Compound Name | [(1E)-1-ethoxybuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 10487466 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | [(1E)-1-ethoxybuta-1,3-dienyl]benzene |
| SMILES | C=C/C=C(/OCC)c1ccccc1 |
| InChI | InChI=1S/C12H14O/c1-3-8-12(13-4-2)11-9-6-5-7-10-11/h3,5-10H,1,4H2,2H3/b12-8+ |
| InChIKey | HQACBXRIEDYYIN-XYOKQWHBSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|