C14H16O — CID 142021955
(3Z,5Z)-5-phenylocta-3,5,7-trien-3-ol (PubChem CID 142021955) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is (3Z,5Z)-5-phenylocta-3,5,7-trien-3-ol.
| Compound Name | (3Z,5Z)-5-phenylocta-3,5,7-trien-3-ol |
|---|---|
| PubChem CID | 142021955 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (3Z,5Z)-5-phenylocta-3,5,7-trien-3-ol |
| SMILES | C=C/C=C(/C=C(\O)CC)c1ccccc1 |
| InChI | InChI=1S/C14H16O/c1-3-8-13(11-14(15)4-2)12-9-6-5-7-10-12/h3,5-11,15H,1,4H2,2H3/b13-8-,14-11- |
| InChIKey | HRPKEJBTDLOEPA-IPLJFLPMSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|