C15H18 — CID 142040611
[(3E,5Z)-5-ethylhepta-1,3,5-trien-4-yl]benzene (PubChem CID 142040611) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is [(3E,5Z)-5-ethylhepta-1,3,5-trien-4-yl]benzene.
| Compound Name | [(3E,5Z)-5-ethylhepta-1,3,5-trien-4-yl]benzene |
|---|---|
| PubChem CID | 142040611 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(3E,5Z)-5-ethylhepta-1,3,5-trien-4-yl]benzene |
| SMILES | C=C/C=C(C(=C/C)\CC)/c1ccccc1 |
| InChI | InChI=1S/C15H18/c1-4-10-15(13(5-2)6-3)14-11-8-7-9-12-14/h4-5,7-12H,1,6H2,2-3H3/b13-5-,15-10+ |
| InChIKey | GTWUACCUXXQZTO-UISDEUSISA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|