C16H27N2P — CID 144910612
ethane;methanamine;(3Z)-N-methyl-3-phenyl-N-phosphanylhexa-1,3,5-trien-2-amine (PubChem CID 144910612) has the molecular formula C16H27N2P and a molecular weight of 278.38 g/mol. Its IUPAC name is ethane;methanamine;(3Z)-N-methyl-3-phenyl-N-phosphanylhexa-1,3,5-trien-2-amine.
| Compound Name | ethane;methanamine;(3Z)-N-methyl-3-phenyl-N-phosphanylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 144910612 |
| Molecular Formula | C16H27N2P |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethane;methanamine;(3Z)-N-methyl-3-phenyl-N-phosphanylhexa-1,3,5-trien-2-amine |
| SMILES | C=C/C=C(\C(=C)N(C)P)c1ccccc1.CC.CN |
| InChI | InChI=1S/C13H16NP.C2H6.CH5N/c1-4-8-13(11(2)14(3)15)12-9-6-5-7-10-12;2*1-2/h4-10H,1-2,15H2,3H3;1-2H3;2H2,1H3/b13-8+;; |
| InChIKey | DRHPDTFGPTVBMW-LIYVDSPJSA-N |
| XLogP | 4.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|