C43H33N5 — CID 135247317
N-[amino(phenyl)methylidene]-N'-benzyl-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]benzenecarboximidamide (PubChem CID 135247317) has the molecular formula C43H33N5 and a molecular weight of 619.77 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-N'-benzyl-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]benzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-N'-benzyl-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 135247317 |
| Molecular Formula | C43H33N5 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | N-[amino(phenyl)methylidene]-N'-benzyl-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]benzenecarboximidamide |
| SMILES | N/C(=N\C(=N/Cc1ccccc1)c1ccccc1-c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H33N5/c44-41(35-19-9-3-10-20-35)48-43(45-30-31-15-5-1-6-16-31)38-24-14-13-23-37(38)32-25-27-34(28-26-32)40-29-39(33-17-7-2-8-18-33)46-42(47-40)36-21-11-4-12-22-36/h1-29H,30H2,(H2,44,45,48) |
| InChIKey | ZAIHVRZPAWPSLU-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|