C59H42N4 — CID 89016678
N'-[N-[1-[4-[4,6-bis(4-phenylphenyl)benzo[h]quinolin-2-yl]phenyl]ethenyl]-C-phenylcarbonimidoyl]benzenecarboximidamide (PubChem CID 89016678) has the molecular formula C59H42N4 and a molecular weight of 807.01 g/mol. Its IUPAC name is N'-[N-[1-[4-[4,6-bis(4-phenylphenyl)benzo[h]quinolin-2-yl]phenyl]ethenyl]-C-phenylcarbonimidoyl]benzenecarboximidamide.
| Compound Name | N'-[N-[1-[4-[4,6-bis(4-phenylphenyl)benzo[h]quinolin-2-yl]phenyl]ethenyl]-C-phenylcarbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 89016678 |
| Molecular Formula | C59H42N4 |
| Molecular Weight | 807.01 g/mol |
| Exact Mass | 806.34 |
| IUPAC Name | N'-[N-[1-[4-[4,6-bis(4-phenylphenyl)benzo[h]quinolin-2-yl]phenyl]ethenyl]-C-phenylcarbonimidoyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/N)c1ccccc1)c1ccccc1)c1ccc(-c2cc(-c3ccc(-c4ccccc4)cc3)c3cc(-c4ccc(-c5ccccc5)cc4)c4ccccc4c3n2)cc1 |
| InChI | InChI=1S/C59H42N4/c1-40(61-59(50-22-12-5-13-23-50)63-58(60)49-20-10-4-11-21-49)41-26-36-48(37-27-41)56-39-54(47-34-30-45(31-35-47)43-18-8-3-9-19-43)55-38-53(51-24-14-15-25-52(51)57(55)62-56)46-32-28-44(29-33-46)42-16-6-2-7-17-42/h2-39H,1H2,(H2,60,61,63) |
| InChIKey | PWZUCFBPHDHQQF-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.01 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|