C44H30F2N6 — CID 135247116
7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluoro-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]fluorene-2-carboximidamide (PubChem CID 135247116) has the molecular formula C44H30F2N6 and a molecular weight of 680.76 g/mol. Its IUPAC name is 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluoro-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]fluorene-2-carboximidamide.
| Compound Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluoro-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]fluorene-2-carboximidamide |
|---|---|
| PubChem CID | 135247116 |
| Molecular Formula | C44H30F2N6 |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.25 |
| IUPAC Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluoro-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]fluorene-2-carboximidamide |
| SMILES | C=C(/N=C(/N=C(\N)c1ccc2c(c1)C(F)(F)c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc1-2)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H30F2N6/c1-28(29-14-6-2-7-15-29)48-40(30-16-8-3-9-17-30)49-39(47)33-22-24-35-36-25-23-34(27-38(36)44(45,46)37(35)26-33)43-51-41(31-18-10-4-11-19-31)50-42(52-43)32-20-12-5-13-21-32/h2-27H,1H2,(H2,47,48,49) |
| InChIKey | FCZMCNKYGIQKRS-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|