C36H21F2N5S — CID 134271912
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-2-yl]-5-phenyl-1,3,4-thiadiazole (PubChem CID 134271912) has the molecular formula C36H21F2N5S and a molecular weight of 593.66 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-2-yl]-5-phenyl-1,3,4-thiadiazole.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-2-yl]-5-phenyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 134271912 |
| Molecular Formula | C36H21F2N5S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-2-yl]-5-phenyl-1,3,4-thiadiazole |
| SMILES | FC1(F)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccc(-c3nnc(-c4ccccc4)s3)cc21 |
| InChI | InChI=1S/C36H21F2N5S/c37-36(38)29-20-25(33-40-31(22-10-4-1-5-11-22)39-32(41-33)23-12-6-2-7-13-23)16-18-27(29)28-19-17-26(21-30(28)36)35-43-42-34(44-35)24-14-8-3-9-15-24/h1-21H |
| InChIKey | GWGNKXVEURBVIP-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |