C36H21F2N5 — CID 134271900
5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-2-yl]quinoxaline (PubChem CID 134271900) has the molecular formula C36H21F2N5 and a molecular weight of 561.60 g/mol. Its IUPAC name is 5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-2-yl]quinoxaline.
| Compound Name | 5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-2-yl]quinoxaline |
|---|---|
| PubChem CID | 134271900 |
| Molecular Formula | C36H21F2N5 |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-2-yl]quinoxaline |
| SMILES | FC1(F)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccc(-c3cccc4nccnc34)cc21 |
| InChI | InChI=1S/C36H21F2N5/c37-36(38)29-20-24(26-12-7-13-31-32(26)40-19-18-39-31)14-16-27(29)28-17-15-25(21-30(28)36)35-42-33(22-8-3-1-4-9-22)41-34(43-35)23-10-5-2-6-11-23/h1-21H |
| InChIKey | MYLXBJRCYMTJIX-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |