C34H26N4 — CID 88979108
3-carbazol-9-yl-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide (PubChem CID 88979108) has the molecular formula C34H26N4 and a molecular weight of 490.61 g/mol. Its IUPAC name is 3-carbazol-9-yl-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide.
| Compound Name | 3-carbazol-9-yl-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 88979108 |
| Molecular Formula | C34H26N4 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 3-carbazol-9-yl-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(/N=C(\N)c1cccc(-n2c3ccccc3c3ccccc32)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H26N4/c1-24(25-13-4-2-5-14-25)36-34(26-15-6-3-7-16-26)37-33(35)27-17-12-18-28(23-27)38-31-21-10-8-19-29(31)30-20-9-11-22-32(30)38/h2-23H,1H2,(H2,35,36,37) |
| InChIKey | OZKGILIWNTYBNW-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|