C40H29N5 — CID 167096637
N'-(1-phenylethenyl)-N-(1-phenylethylidene)-3-(3,9,20-triazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-20-yl)benzenecarboximidamide (PubChem CID 167096637) has the molecular formula C40H29N5 and a molecular weight of 579.71 g/mol. Its IUPAC name is N'-(1-phenylethenyl)-N-(1-phenylethylidene)-3-(3,9,20-triazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-20-yl)benzenecarboximidamide.
| Compound Name | N'-(1-phenylethenyl)-N-(1-phenylethylidene)-3-(3,9,20-triazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-20-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 167096637 |
| Molecular Formula | C40H29N5 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | N'-(1-phenylethenyl)-N-(1-phenylethylidene)-3-(3,9,20-triazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-20-yl)benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccccc1)c1cccc(-n2c3ccccc3c3ccc4c(nc5ccccn54)c32)c1)c1ccccc1 |
| InChI | InChI=1S/C40H29N5/c1-27(29-14-5-3-6-15-29)41-40(42-28(2)30-16-7-4-8-17-30)31-18-13-19-32(26-31)45-35-21-10-9-20-33(35)34-23-24-36-38(39(34)45)43-37-22-11-12-25-44(36)37/h3-26H,1H2,2H3/b41-40-,42-28+ |
| InChIKey | UDJMDHCVVAOARV-CXHAFSIJSA-N |
| XLogP | 9.51 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|