C41H29N3S — CID 144605832
N'-(1-phenylethenyl)-N-[1-[4-(3-thia-11-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-1(12),2(10),4,6,8,13,15,17,19-nonaen-11-yl)phenyl]ethylidene]benzenecarboximidamide (PubChem CID 144605832) has the molecular formula C41H29N3S and a molecular weight of 595.77 g/mol. Its IUPAC name is N'-(1-phenylethenyl)-N-[1-[4-(3-thia-11-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-1(12),2(10),4,6,8,13,15,17,19-nonaen-11-yl)phenyl]ethylidene]benzenecarboximidamide.
| Compound Name | N'-(1-phenylethenyl)-N-[1-[4-(3-thia-11-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-1(12),2(10),4,6,8,13,15,17,19-nonaen-11-yl)phenyl]ethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 144605832 |
| Molecular Formula | C41H29N3S |
| Molecular Weight | 595.77 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | N'-(1-phenylethenyl)-N-[1-[4-(3-thia-11-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-1(12),2(10),4,6,8,13,15,17,19-nonaen-11-yl)phenyl]ethylidene]benzenecarboximidamide |
| SMILES | C=C(/N=C(/N=C(\C)c1ccc(-n2c3c4ccccc4ccc3c3sc4ccccc4c32)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H29N3S/c1-27(29-13-5-3-6-14-29)42-41(32-16-7-4-8-17-32)43-28(2)30-21-24-33(25-22-30)44-38-34-18-10-9-15-31(34)23-26-36(38)40-39(44)35-19-11-12-20-37(35)45-40/h3-26H,1H2,2H3/b42-41+,43-28+ |
| InChIKey | XEKSTGUQEFTRML-JAMIJYSZSA-N |
| XLogP | 11.08 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.77 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|