C40H28N4S — CID 170153892
N'-(1-phenylethenyl)-N-[1-(9-pyrido[2,3-b]indol-9-yldibenzothiophen-2-yl)ethylidene]benzenecarboximidamide (PubChem CID 170153892) has the molecular formula C40H28N4S and a molecular weight of 596.76 g/mol. Its IUPAC name is N'-(1-phenylethenyl)-N-[1-(9-pyrido[2,3-b]indol-9-yldibenzothiophen-2-yl)ethylidene]benzenecarboximidamide.
| Compound Name | N'-(1-phenylethenyl)-N-[1-(9-pyrido[2,3-b]indol-9-yldibenzothiophen-2-yl)ethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 170153892 |
| Molecular Formula | C40H28N4S |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | N'-(1-phenylethenyl)-N-[1-(9-pyrido[2,3-b]indol-9-yldibenzothiophen-2-yl)ethylidene]benzenecarboximidamide |
| SMILES | C=C(/N=C(/N=C(\C)c1ccc2sc3cccc(-n4c5ccccc5c5cccnc54)c3c2c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H28N4S/c1-26(28-13-5-3-6-14-28)42-39(29-15-7-4-8-16-29)43-27(2)30-22-23-36-33(25-30)38-35(20-11-21-37(38)45-36)44-34-19-10-9-17-31(34)32-18-12-24-41-40(32)44/h3-25H,1H2,2H3/b42-39+,43-27+ |
| InChIKey | QJVLEEBMBOURID-UMVDZWTGSA-N |
| XLogP | 10.47 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|