C47H33N3O — CID 144782067
3-(6-carbazol-9-yldibenzofuran-4-yl)-N'-(1-phenylethenyl)-N-(1-phenylethylidene)benzenecarboximidamide (PubChem CID 144782067) has the molecular formula C47H33N3O and a molecular weight of 655.80 g/mol. Its IUPAC name is 3-(6-carbazol-9-yldibenzofuran-4-yl)-N'-(1-phenylethenyl)-N-(1-phenylethylidene)benzenecarboximidamide.
| Compound Name | 3-(6-carbazol-9-yldibenzofuran-4-yl)-N'-(1-phenylethenyl)-N-(1-phenylethylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 144782067 |
| Molecular Formula | C47H33N3O |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | 3-(6-carbazol-9-yldibenzofuran-4-yl)-N'-(1-phenylethenyl)-N-(1-phenylethylidene)benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccccc1)c1cccc(-c2cccc3c2oc2c(-n4c5ccccc5c5ccccc54)cccc23)c1)c1ccccc1 |
| InChI | InChI=1S/C47H33N3O/c1-31(33-16-5-3-6-17-33)48-47(49-32(2)34-18-7-4-8-19-34)36-21-13-20-35(30-36)37-24-14-25-40-41-26-15-29-44(46(41)51-45(37)40)50-42-27-11-9-22-38(42)39-23-10-12-28-43(39)50/h3-30H,1H2,2H3/b48-47-,49-32+ |
| InChIKey | DDRCOFRQOPVBNU-CNKMCWGESA-N |
| XLogP | 12.28 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|