C54H39N3O — CID 146335675
N-[1-[9-(2-phenylcarbazol-9-yl)dibenzofuran-3-yl]propylidene]-N'-[1-(3-phenylphenyl)ethenyl]benzenecarboximidamide (PubChem CID 146335675) has the molecular formula C54H39N3O and a molecular weight of 745.93 g/mol. Its IUPAC name is N-[1-[9-(2-phenylcarbazol-9-yl)dibenzofuran-3-yl]propylidene]-N'-[1-(3-phenylphenyl)ethenyl]benzenecarboximidamide.
| Compound Name | N-[1-[9-(2-phenylcarbazol-9-yl)dibenzofuran-3-yl]propylidene]-N'-[1-(3-phenylphenyl)ethenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 146335675 |
| Molecular Formula | C54H39N3O |
| Molecular Weight | 745.93 g/mol |
| Exact Mass | 745.31 |
| IUPAC Name | N-[1-[9-(2-phenylcarbazol-9-yl)dibenzofuran-3-yl]propylidene]-N'-[1-(3-phenylphenyl)ethenyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(/N=C(\CC)c1ccc2c(c1)oc1cccc(-n3c4ccccc4c4ccc(-c5ccccc5)cc43)c12)c1ccccc1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C54H39N3O/c1-3-47(56-54(39-21-11-6-12-22-39)55-36(2)40-23-15-24-41(33-40)37-17-7-4-8-18-37)43-30-32-46-52(35-43)58-51-28-16-27-49(53(46)51)57-48-26-14-13-25-44(48)45-31-29-42(34-50(45)57)38-19-9-5-10-20-38/h4-35H,2-3H2,1H3/b55-54+,56-47+ |
| InChIKey | JPAFRZKFCOVUSY-BXHYMGLUSA-N |
| XLogP | 14.33 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.93 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|