C40H32N2 — CID 166866290
N-[1-[4-[4-[1-[(Z)-but-2-en-2-yl]-2-ethynylbenzo[e]indol-3-yl]phenyl]phenyl]ethenyl]-1-phenylethanimine (PubChem CID 166866290) has the molecular formula C40H32N2 and a molecular weight of 540.71 g/mol. Its IUPAC name is N-[1-[4-[4-[1-[(Z)-but-2-en-2-yl]-2-ethynylbenzo[e]indol-3-yl]phenyl]phenyl]ethenyl]-1-phenylethanimine.
| Compound Name | N-[1-[4-[4-[1-[(Z)-but-2-en-2-yl]-2-ethynylbenzo[e]indol-3-yl]phenyl]phenyl]ethenyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 166866290 |
| Molecular Formula | C40H32N2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | N-[1-[4-[4-[1-[(Z)-but-2-en-2-yl]-2-ethynylbenzo[e]indol-3-yl]phenyl]phenyl]ethenyl]-1-phenylethanimine |
| SMILES | C#Cc1c(/C(C)=C\C)c2c3ccccc3ccc2n1-c1ccc(-c2ccc(C(=C)/N=C(\C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C40H32N2/c1-6-27(3)39-37(7-2)42(38-26-23-34-15-11-12-16-36(34)40(38)39)35-24-21-33(22-25-35)32-19-17-31(18-20-32)29(5)41-28(4)30-13-9-8-10-14-30/h2,6,8-26H,5H2,1,3-4H3/b27-6-,41-28+ |
| InChIKey | HTIKJKYSMVJTMD-SZVYJGDMSA-N |
| XLogP | 10.34 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|