C42H34N2 — CID 144542320
1-phenyl-N-[(Z)-3-phenyl-1-[9-(4-phenylphenyl)carbazol-3-yl]but-1-enyl]ethanimine (PubChem CID 144542320) has the molecular formula C42H34N2 and a molecular weight of 566.75 g/mol. Its IUPAC name is 1-phenyl-N-[(Z)-3-phenyl-1-[9-(4-phenylphenyl)carbazol-3-yl]but-1-enyl]ethanimine.
| Compound Name | 1-phenyl-N-[(Z)-3-phenyl-1-[9-(4-phenylphenyl)carbazol-3-yl]but-1-enyl]ethanimine |
|---|---|
| PubChem CID | 144542320 |
| Molecular Formula | C42H34N2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 1-phenyl-N-[(Z)-3-phenyl-1-[9-(4-phenylphenyl)carbazol-3-yl]but-1-enyl]ethanimine |
| SMILES | C/C(=N\C(=C/C(C)c1ccccc1)c1ccc2c(c1)c1ccccc1n2-c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C42H34N2/c1-30(32-14-6-3-7-15-32)28-40(43-31(2)33-16-8-4-9-17-33)36-24-27-42-39(29-36)38-20-12-13-21-41(38)44(42)37-25-22-35(23-26-37)34-18-10-5-11-19-34/h3-30H,1-2H3/b40-28-,43-31+ |
| InChIKey | OXBNIOHWSVAYBE-RSDDBJEJSA-N |
| XLogP | 11.10 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|