C53H41N3 — CID 145064023
N-[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]-N'-[1-[4-(3-phenanthren-9-ylbenzo[c]carbazol-7-yl)phenyl]ethenyl]benzenecarboximidamide (PubChem CID 145064023) has the molecular formula C53H41N3 and a molecular weight of 719.93 g/mol. Its IUPAC name is N-[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]-N'-[1-[4-(3-phenanthren-9-ylbenzo[c]carbazol-7-yl)phenyl]ethenyl]benzenecarboximidamide.
| Compound Name | N-[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]-N'-[1-[4-(3-phenanthren-9-ylbenzo[c]carbazol-7-yl)phenyl]ethenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145064023 |
| Molecular Formula | C53H41N3 |
| Molecular Weight | 719.93 g/mol |
| Exact Mass | 719.33 |
| IUPAC Name | N-[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]-N'-[1-[4-(3-phenanthren-9-ylbenzo[c]carbazol-7-yl)phenyl]ethenyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(C)\C(/C=C\C)=C\C)c1ccccc1)c1ccc(-n2c3ccccc3c3c4ccc(-c5cc6ccccc6c6ccccc56)cc4ccc32)cc1 |
| InChI | InChI=1S/C53H41N3/c1-5-16-37(6-2)35(3)54-53(39-17-8-7-9-18-39)55-36(4)38-25-29-43(30-26-38)56-50-24-15-14-23-48(50)52-45-31-27-42(33-41(45)28-32-51(52)56)49-34-40-19-10-11-20-44(40)46-21-12-13-22-47(46)49/h5-34H,4H2,1-3H3/b16-5-,37-6+,54-35+,55-53- |
| InChIKey | MDXWETINGNGPRD-CXOXPTHUSA-N |
| XLogP | 14.31 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.93 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|