C40H31N3 — CID 145000761
3-phenyl-N'-[C-(3-phenylphenyl)-N-[1-(3-phenylphenyl)ethenyl]carbonimidoyl]benzenecarboximidamide (PubChem CID 145000761) has the molecular formula C40H31N3 and a molecular weight of 553.71 g/mol. Its IUPAC name is 3-phenyl-N'-[C-(3-phenylphenyl)-N-[1-(3-phenylphenyl)ethenyl]carbonimidoyl]benzenecarboximidamide.
| Compound Name | 3-phenyl-N'-[C-(3-phenylphenyl)-N-[1-(3-phenylphenyl)ethenyl]carbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145000761 |
| Molecular Formula | C40H31N3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 3-phenyl-N'-[C-(3-phenylphenyl)-N-[1-(3-phenylphenyl)ethenyl]carbonimidoyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(/N=C(\N)c1cccc(-c2ccccc2)c1)c1cccc(-c2ccccc2)c1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C40H31N3/c1-29(33-20-11-21-34(26-33)30-14-5-2-6-15-30)42-40(38-25-13-23-36(28-38)32-18-9-4-10-19-32)43-39(41)37-24-12-22-35(27-37)31-16-7-3-8-17-31/h2-28H,1H2,(H2,41,42,43) |
| InChIKey | RIPPQWBKEMWKCC-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|