C30H27BrN2 — CID 145257325
3-bromo-5-phenyl-N'-(1-phenylethenyl)-N-(1-phenylethylidene)benzenecarboximidamide;methane (PubChem CID 145257325) has the molecular formula C30H27BrN2 and a molecular weight of 495.46 g/mol. Its IUPAC name is 3-bromo-5-phenyl-N'-(1-phenylethenyl)-N-(1-phenylethylidene)benzenecarboximidamide;methane.
| Compound Name | 3-bromo-5-phenyl-N'-(1-phenylethenyl)-N-(1-phenylethylidene)benzenecarboximidamide;methane |
|---|---|
| PubChem CID | 145257325 |
| Molecular Formula | C30H27BrN2 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 3-bromo-5-phenyl-N'-(1-phenylethenyl)-N-(1-phenylethylidene)benzenecarboximidamide;methane |
| SMILES | C.C=C(/N=C(\N=C(/C)c1ccccc1)c1cc(Br)cc(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H23BrN2.CH4/c1-21(23-12-6-3-7-13-23)31-29(32-22(2)24-14-8-4-9-15-24)27-18-26(19-28(30)20-27)25-16-10-5-11-17-25;/h3-20H,1H2,2H3;1H4/b31-29-,32-22+; |
| InChIKey | JZGVGKQWBBNDRP-CAZIUKMPSA-N |
| XLogP | 8.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|