C60H45N — CID 130292214
1-[3-phenyl-5-(4-phenylphenyl)phenyl]-N-[(1Z)-1-phenyl-3-[3-phenyl-5-(4-phenylphenyl)phenyl]buta-1,3-dienyl]ethanimine (PubChem CID 130292214) has the molecular formula C60H45N and a molecular weight of 780.03 g/mol. Its IUPAC name is 1-[3-phenyl-5-(4-phenylphenyl)phenyl]-N-[(1Z)-1-phenyl-3-[3-phenyl-5-(4-phenylphenyl)phenyl]buta-1,3-dienyl]ethanimine.
| Compound Name | 1-[3-phenyl-5-(4-phenylphenyl)phenyl]-N-[(1Z)-1-phenyl-3-[3-phenyl-5-(4-phenylphenyl)phenyl]buta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 130292214 |
| Molecular Formula | C60H45N |
| Molecular Weight | 780.03 g/mol |
| Exact Mass | 779.36 |
| IUPAC Name | 1-[3-phenyl-5-(4-phenylphenyl)phenyl]-N-[(1Z)-1-phenyl-3-[3-phenyl-5-(4-phenylphenyl)phenyl]buta-1,3-dienyl]ethanimine |
| SMILES | C=C(/C=C(\N=C(/C)c1cc(-c2ccccc2)cc(-c2ccc(-c3ccccc3)cc2)c1)c1ccccc1)c1cc(-c2ccccc2)cc(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C60H45N/c1-43(54-37-56(47-22-12-5-13-23-47)41-57(38-54)51-32-28-49(29-33-51)45-18-8-3-9-19-45)36-60(53-26-16-7-17-27-53)61-44(2)55-39-58(48-24-14-6-15-25-48)42-59(40-55)52-34-30-50(31-35-52)46-20-10-4-11-21-46/h3-42H,1H2,2H3/b60-36-,61-44+ |
| InChIKey | MGPYYIVFGSODPH-PYOKCCBLSA-N |
| XLogP | 16.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.03 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|