C61H49N3 — CID 163569391
N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[4-[5-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-(2-ethylphenyl)-2-methylphenyl]phenyl]ethanimine (PubChem CID 163569391) has the molecular formula C61H49N3 and a molecular weight of 824.08 g/mol. Its IUPAC name is N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[4-[5-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-(2-ethylphenyl)-2-methylphenyl]phenyl]ethanimine.
| Compound Name | N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[4-[5-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-(2-ethylphenyl)-2-methylphenyl]phenyl]ethanimine |
|---|---|
| PubChem CID | 163569391 |
| Molecular Formula | C61H49N3 |
| Molecular Weight | 824.08 g/mol |
| Exact Mass | 823.39 |
| IUPAC Name | N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[4-[5-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-(2-ethylphenyl)-2-methylphenyl]phenyl]ethanimine |
| SMILES | C=C(/C=C(\N=C(/C)c1ccc(-c2cc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc(-c3ccccc3CC)c2C)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C61H49N3/c1-5-45-20-18-19-29-55(45)57-40-54(48-32-36-52(37-33-48)60-41-59(51-25-14-8-15-26-51)63-61(64-60)53-27-16-9-17-28-53)39-56(43(57)3)49-34-30-47(31-35-49)44(4)62-58(50-23-12-7-13-24-50)38-42(2)46-21-10-6-11-22-46/h6-41H,2,5H2,1,3-4H3/b58-38-,62-44+ |
| InChIKey | FXZCJEOLVYFPEH-HCTRLNQASA-N |
| XLogP | 15.91 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.08 |
| LogP ≤ 5 | 15.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|