C54H43N3 — CID 144969058
N-[(1Z)-3-[3-[5-methyl-4-(2-methylphenyl)-6-phenylpyrimidin-2-yl]-5-(3-phenylphenyl)phenyl]-1-phenylbuta-1,3-dienyl]-1-phenylethanimine (PubChem CID 144969058) has the molecular formula C54H43N3 and a molecular weight of 733.96 g/mol. Its IUPAC name is N-[(1Z)-3-[3-[5-methyl-4-(2-methylphenyl)-6-phenylpyrimidin-2-yl]-5-(3-phenylphenyl)phenyl]-1-phenylbuta-1,3-dienyl]-1-phenylethanimine.
| Compound Name | N-[(1Z)-3-[3-[5-methyl-4-(2-methylphenyl)-6-phenylpyrimidin-2-yl]-5-(3-phenylphenyl)phenyl]-1-phenylbuta-1,3-dienyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 144969058 |
| Molecular Formula | C54H43N3 |
| Molecular Weight | 733.96 g/mol |
| Exact Mass | 733.35 |
| IUPAC Name | N-[(1Z)-3-[3-[5-methyl-4-(2-methylphenyl)-6-phenylpyrimidin-2-yl]-5-(3-phenylphenyl)phenyl]-1-phenylbuta-1,3-dienyl]-1-phenylethanimine |
| SMILES | C=C(/C=C(\N=C(/C)c1ccccc1)c1ccccc1)c1cc(-c2cccc(-c3ccccc3)c2)cc(-c2nc(-c3ccccc3)c(C)c(-c3ccccc3C)n2)c1 |
| InChI | InChI=1S/C54H43N3/c1-37-20-17-18-31-50(37)53-39(3)52(44-27-15-8-16-28-44)56-54(57-53)49-35-47(34-48(36-49)46-30-19-29-45(33-46)42-23-11-6-12-24-42)38(2)32-51(43-25-13-7-14-26-43)55-40(4)41-21-9-5-10-22-41/h5-36H,2H2,1,3-4H3/b51-32-,55-40+ |
| InChIKey | MQKPIKFAFVYTSX-SINKNMAMSA-N |
| XLogP | 13.99 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.96 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|