C32H29N — CID 144588515
1-[3-(4-methylphenyl)phenyl]-N-[(1Z)-3-(4-methylphenyl)-1-phenylbuta-1,3-dienyl]ethanimine (PubChem CID 144588515) has the molecular formula C32H29N and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[3-(4-methylphenyl)phenyl]-N-[(1Z)-3-(4-methylphenyl)-1-phenylbuta-1,3-dienyl]ethanimine.
| Compound Name | 1-[3-(4-methylphenyl)phenyl]-N-[(1Z)-3-(4-methylphenyl)-1-phenylbuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 144588515 |
| Molecular Formula | C32H29N |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 1-[3-(4-methylphenyl)phenyl]-N-[(1Z)-3-(4-methylphenyl)-1-phenylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C(/C=C(\N=C(/C)c1cccc(-c2ccc(C)cc2)c1)c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H29N/c1-23-13-17-27(18-14-23)25(3)21-32(29-9-6-5-7-10-29)33-26(4)30-11-8-12-31(22-30)28-19-15-24(2)16-20-28/h5-22H,3H2,1-2,4H3/b32-21-,33-26+ |
| InChIKey | BOZDIQBLSLODBF-BWFOSNMDSA-N |
| XLogP | 8.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|