C56H41NO — CID 155112395
N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[3-[2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,6'-indeno[2,1-g][1]benzofuran]-1-yl]phenyl]ethanimine (PubChem CID 155112395) has the molecular formula C56H41NO and a molecular weight of 743.95 g/mol. Its IUPAC name is N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[3-[2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,6'-indeno[2,1-g][1]benzofuran]-1-yl]phenyl]ethanimine.
| Compound Name | N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[3-[2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,6'-indeno[2,1-g][1]benzofuran]-1-yl]phenyl]ethanimine |
|---|---|
| PubChem CID | 155112395 |
| Molecular Formula | C56H41NO |
| Molecular Weight | 743.95 g/mol |
| Exact Mass | 743.32 |
| IUPAC Name | N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[3-[2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,6'-indeno[2,1-g][1]benzofuran]-1-yl]phenyl]ethanimine |
| SMILES | C=Cc1oc2c3c(ccc2c1/C=C\C)C1(c2ccccc2-c2cccc(-c4cccc(/C(C)=N/C(=C\C(=C)c5ccccc5)c5ccccc5)c4)c21)c1ccccc1-3 |
| InChI | InChI=1S/C56H41NO/c1-5-19-44-46-32-33-50-53(55(46)58-52(44)6-2)47-27-14-16-31-49(47)56(50)48-30-15-13-26-43(48)45-29-18-28-42(54(45)56)41-25-17-24-40(35-41)37(4)57-51(39-22-11-8-12-23-39)34-36(3)38-20-9-7-10-21-38/h5-35H,2-3H2,1,4H3/b19-5-,51-34-,57-37+ |
| InChIKey | GVZVZGZECQRZRQ-GEZGRVHYSA-N |
| XLogP | 14.68 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.95 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|