C50H40 — CID 144969249
1-[(3E,5E)-4-(3,5-diphenylphenyl)-6-(4-methylphenyl)hepta-1,3,5-trien-2-yl]-3,5-diphenylbenzene (PubChem CID 144969249) has the molecular formula C50H40 and a molecular weight of 640.87 g/mol. Its IUPAC name is 1-[(3E,5E)-4-(3,5-diphenylphenyl)-6-(4-methylphenyl)hepta-1,3,5-trien-2-yl]-3,5-diphenylbenzene.
| Compound Name | 1-[(3E,5E)-4-(3,5-diphenylphenyl)-6-(4-methylphenyl)hepta-1,3,5-trien-2-yl]-3,5-diphenylbenzene |
|---|---|
| PubChem CID | 144969249 |
| Molecular Formula | C50H40 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | 1-[(3E,5E)-4-(3,5-diphenylphenyl)-6-(4-methylphenyl)hepta-1,3,5-trien-2-yl]-3,5-diphenylbenzene |
| SMILES | C=C(/C=C(\C=C(/C)c1ccc(C)cc1)c1cc(-c2ccccc2)cc(-c2ccccc2)c1)c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C50H40/c1-36-24-26-39(27-25-36)37(2)28-45(50-34-48(42-20-12-6-13-21-42)33-49(35-50)43-22-14-7-15-23-43)29-38(3)44-30-46(40-16-8-4-9-17-40)32-47(31-44)41-18-10-5-11-19-41/h4-35H,3H2,1-2H3/b37-28+,45-29+ |
| InChIKey | RRPMHABGMMAIEL-FFHRUTIYSA-N |
| XLogP | 13.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|