C80H57N3 — CID 146332251
4-[4-[(3E,5E)-2,6-diphenylhepta-1,3,5-trien-4-yl]phenyl]-2-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-6,8-bis(3-phenylphenyl)quinazoline (PubChem CID 146332251) has the molecular formula C80H57N3 and a molecular weight of 1060.36 g/mol. Its IUPAC name is 4-[4-[(3E,5E)-2,6-diphenylhepta-1,3,5-trien-4-yl]phenyl]-2-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-6,8-bis(3-phenylphenyl)quinazoline.
| Compound Name | 4-[4-[(3E,5E)-2,6-diphenylhepta-1,3,5-trien-4-yl]phenyl]-2-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-6,8-bis(3-phenylphenyl)quinazoline |
|---|---|
| PubChem CID | 146332251 |
| Molecular Formula | C80H57N3 |
| Molecular Weight | 1060.36 g/mol |
| Exact Mass | 1059.46 |
| IUPAC Name | 4-[4-[(3E,5E)-2,6-diphenylhepta-1,3,5-trien-4-yl]phenyl]-2-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-6,8-bis(3-phenylphenyl)quinazoline |
| SMILES | C=C(/C=C(\C=C(/C)c1ccccc1)c1ccc(-c2nc(-c3ccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)n4)cc3)nc3c(-c4cccc(-c5ccccc5)c4)cc(-c4cccc(-c5ccccc5)c4)cc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C80H57N3/c1-55(57-23-9-3-10-24-57)47-71(48-56(2)58-25-11-4-12-26-58)62-39-43-65(44-40-62)78-75-52-72(69-37-21-35-67(49-69)59-27-13-5-14-28-59)51-74(70-38-22-36-68(50-70)60-29-15-6-16-30-60)79(75)83-80(82-78)66-45-41-64(42-46-66)77-54-73(61-31-17-7-18-32-61)53-76(81-77)63-33-19-8-20-34-63/h3-54H,1H2,2H3/b56-48+,71-47+ |
| InChIKey | AHOKBYRYLCKNON-BQHFXRGGSA-N |
| XLogP | 21.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.36 |
| LogP ≤ 5 | 21.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|