C74H48N4 — CID 146332083
2-(2,3-diphenylquinolin-7-yl)-4-(2,4-diphenylquinolin-7-yl)-6,8-bis(3-phenylphenyl)quinazoline (PubChem CID 146332083) has the molecular formula C74H48N4 and a molecular weight of 993.23 g/mol. Its IUPAC name is 2-(2,3-diphenylquinolin-7-yl)-4-(2,4-diphenylquinolin-7-yl)-6,8-bis(3-phenylphenyl)quinazoline.
| Compound Name | 2-(2,3-diphenylquinolin-7-yl)-4-(2,4-diphenylquinolin-7-yl)-6,8-bis(3-phenylphenyl)quinazoline |
|---|---|
| PubChem CID | 146332083 |
| Molecular Formula | C74H48N4 |
| Molecular Weight | 993.23 g/mol |
| Exact Mass | 992.39 |
| IUPAC Name | 2-(2,3-diphenylquinolin-7-yl)-4-(2,4-diphenylquinolin-7-yl)-6,8-bis(3-phenylphenyl)quinazoline |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4cccc(-c5ccccc5)c4)c4nc(-c5ccc6cc(-c7ccccc7)c(-c7ccccc7)nc6c5)nc(-c5ccc6c(-c7ccccc7)cc(-c7ccccc7)nc6c5)c4c3)c2)cc1 |
| InChI | InChI=1S/C74H48N4/c1-7-21-49(22-8-1)55-33-19-35-57(41-55)62-44-66(58-36-20-34-56(42-58)50-23-9-2-10-24-50)73-67(45-62)72(60-39-40-63-64(51-25-11-3-12-26-51)48-69(75-70(63)46-60)53-29-15-5-16-30-53)77-74(78-73)61-38-37-59-43-65(52-27-13-4-14-28-52)71(76-68(59)47-61)54-31-17-6-18-32-54/h1-48H |
| InChIKey | JXKIXXKCALEOLN-UHFFFAOYSA-N |
| XLogP | 19.40 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.23 |
| LogP ≤ 5 | 19.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |