C46H43N — CID 143905972
1-ethyl-2-(2-methylphenyl)benzene;(E)-3-[3-(4-methylphenyl)phenyl]-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine (PubChem CID 143905972) has the molecular formula C46H43N and a molecular weight of 609.86 g/mol. Its IUPAC name is 1-ethyl-2-(2-methylphenyl)benzene;(E)-3-[3-(4-methylphenyl)phenyl]-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine.
| Compound Name | 1-ethyl-2-(2-methylphenyl)benzene;(E)-3-[3-(4-methylphenyl)phenyl]-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine |
|---|---|
| PubChem CID | 143905972 |
| Molecular Formula | C46H43N |
| Molecular Weight | 609.86 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | 1-ethyl-2-(2-methylphenyl)benzene;(E)-3-[3-(4-methylphenyl)phenyl]-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine |
| SMILES | C=C(/N=C(/C=C(\C)c1cccc(-c2ccc(C)cc2)c1)c1ccccc1)c1ccccc1.CCc1ccccc1-c1ccccc1C |
| InChI | InChI=1S/C31H27N.C15H16/c1-23-17-19-27(20-18-23)30-16-10-15-29(22-30)24(2)21-31(28-13-8-5-9-14-28)32-25(3)26-11-6-4-7-12-26;1-3-13-9-5-7-11-15(13)14-10-6-4-8-12(14)2/h4-22H,3H2,1-2H3;4-11H,3H2,1-2H3/b24-21+,32-31-; |
| InChIKey | XWHFPLYQRFAYKZ-RRILYUARSA-N |
| XLogP | 12.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.86 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|