C21H23N — CID 142539028
(E)-3,4-dimethyl-1-phenyl-N-(1-phenylethenyl)pent-2-en-1-imine (PubChem CID 142539028) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is (E)-3,4-dimethyl-1-phenyl-N-(1-phenylethenyl)pent-2-en-1-imine.
| Compound Name | (E)-3,4-dimethyl-1-phenyl-N-(1-phenylethenyl)pent-2-en-1-imine |
|---|---|
| PubChem CID | 142539028 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (E)-3,4-dimethyl-1-phenyl-N-(1-phenylethenyl)pent-2-en-1-imine |
| SMILES | C=C(/N=C(/C=C(\C)C(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23N/c1-16(2)17(3)15-21(20-13-9-6-10-14-20)22-18(4)19-11-7-5-8-12-19/h5-16H,4H2,1-3H3/b17-15+,22-21- |
| InChIKey | VYISIQOMZZIAOM-NWKAUVBJSA-N |
| XLogP | 5.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|