C41H33N — CID 166864208
(E)-N-[1-[4-(4-methylphenyl)phenyl]ethenyl]-3-(4-naphthalen-1-ylphenyl)-1-phenylbut-2-en-1-imine (PubChem CID 166864208) has the molecular formula C41H33N and a molecular weight of 539.72 g/mol. Its IUPAC name is (E)-N-[1-[4-(4-methylphenyl)phenyl]ethenyl]-3-(4-naphthalen-1-ylphenyl)-1-phenylbut-2-en-1-imine.
| Compound Name | (E)-N-[1-[4-(4-methylphenyl)phenyl]ethenyl]-3-(4-naphthalen-1-ylphenyl)-1-phenylbut-2-en-1-imine |
|---|---|
| PubChem CID | 166864208 |
| Molecular Formula | C41H33N |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | (E)-N-[1-[4-(4-methylphenyl)phenyl]ethenyl]-3-(4-naphthalen-1-ylphenyl)-1-phenylbut-2-en-1-imine |
| SMILES | C=C(/N=C(/C=C(\C)c1ccc(-c2cccc3ccccc23)cc1)c1ccccc1)c1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C41H33N/c1-29-16-18-34(19-17-29)35-24-22-33(23-25-35)31(3)42-41(38-11-5-4-6-12-38)28-30(2)32-20-26-37(27-21-32)40-15-9-13-36-10-7-8-14-39(36)40/h4-28H,3H2,1-2H3/b30-28+,42-41- |
| InChIKey | CYVMYKJGYXKKCU-UUWOABPESA-N |
| XLogP | 11.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|