C48H39N3 — CID 144705299
(E)-N-[1-[4-(9,18-diazahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaen-9-yl)phenyl]ethenyl]-1,3-diphenylbut-2-en-1-imine;ethane (PubChem CID 144705299) has the molecular formula C48H39N3 and a molecular weight of 657.86 g/mol. Its IUPAC name is (E)-N-[1-[4-(9,18-diazahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaen-9-yl)phenyl]ethenyl]-1,3-diphenylbut-2-en-1-imine;ethane.
| Compound Name | (E)-N-[1-[4-(9,18-diazahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaen-9-yl)phenyl]ethenyl]-1,3-diphenylbut-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 144705299 |
| Molecular Formula | C48H39N3 |
| Molecular Weight | 657.86 g/mol |
| Exact Mass | 657.31 |
| IUPAC Name | (E)-N-[1-[4-(9,18-diazahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaen-9-yl)phenyl]ethenyl]-1,3-diphenylbut-2-en-1-imine;ethane |
| SMILES | C=C(/N=C(\C=C(/C)c1ccccc1)c1ccccc1)c1ccc(-n2c3ccccc3c3c4c5ccccc5[nH]c4c4ccccc4c32)cc1.CC |
| InChI | InChI=1S/C46H33N3.C2H6/c1-30(32-15-5-3-6-16-32)29-41(34-17-7-4-8-18-34)47-31(2)33-25-27-35(28-26-33)49-42-24-14-12-22-39(42)44-43-38-21-11-13-23-40(38)48-45(43)36-19-9-10-20-37(36)46(44)49;1-2/h3-29,48H,2H2,1H3;1-2H3/b30-29+,47-41+; |
| InChIKey | UMMWCKHGVXVSMG-UKEIMRAPSA-N |
| XLogP | 13.16 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.86 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|