C42H33N3 — CID 144705238
N-[(1Z)-3-(9,18-diazahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaen-9-yl)-4-methyl-1-phenylpenta-1,3-dienyl]-1-phenylethanimine (PubChem CID 144705238) has the molecular formula C42H33N3 and a molecular weight of 579.75 g/mol. Its IUPAC name is N-[(1Z)-3-(9,18-diazahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaen-9-yl)-4-methyl-1-phenylpenta-1,3-dienyl]-1-phenylethanimine.
| Compound Name | N-[(1Z)-3-(9,18-diazahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaen-9-yl)-4-methyl-1-phenylpenta-1,3-dienyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 144705238 |
| Molecular Formula | C42H33N3 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | N-[(1Z)-3-(9,18-diazahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaen-9-yl)-4-methyl-1-phenylpenta-1,3-dienyl]-1-phenylethanimine |
| SMILES | CC(C)=C(/C=C(\N=C(/C)c1ccccc1)c1ccccc1)n1c2ccccc2c2c3c4ccccc4[nH]c3c3ccccc3c21 |
| InChI | InChI=1S/C42H33N3/c1-27(2)38(26-36(30-18-8-5-9-19-30)43-28(3)29-16-6-4-7-17-29)45-37-25-15-13-23-34(37)40-39-33-22-12-14-24-35(33)44-41(39)31-20-10-11-21-32(31)42(40)45/h4-26,44H,1-3H3/b36-26-,43-28+ |
| InChIKey | WJOGVNIMPXWUGJ-AMLAQWBYSA-N |
| XLogP | 11.38 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|