C51H39N3 — CID 144730553
(E,E)-N-[1-[10-(9H-carbazol-3-yl)-7,7-dimethylindeno[2,1-b]carbazol-5-yl]ethenyl]-1,3-diphenylbut-2-en-1-imine (PubChem CID 144730553) has the molecular formula C51H39N3 and a molecular weight of 693.89 g/mol. Its IUPAC name is (E,E)-N-[1-[10-(9H-carbazol-3-yl)-7,7-dimethylindeno[2,1-b]carbazol-5-yl]ethenyl]-1,3-diphenylbut-2-en-1-imine.
| Compound Name | (E,E)-N-[1-[10-(9H-carbazol-3-yl)-7,7-dimethylindeno[2,1-b]carbazol-5-yl]ethenyl]-1,3-diphenylbut-2-en-1-imine |
|---|---|
| PubChem CID | 144730553 |
| Molecular Formula | C51H39N3 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.31 |
| IUPAC Name | (E,E)-N-[1-[10-(9H-carbazol-3-yl)-7,7-dimethylindeno[2,1-b]carbazol-5-yl]ethenyl]-1,3-diphenylbut-2-en-1-imine |
| SMILES | C=C(/N=C(\C=C(/C)c1ccccc1)c1ccccc1)n1c2ccccc2c2cc3c(cc21)C(C)(C)c1ccc(-c2ccc4[nH]c5ccccc5c4c2)cc1-3 |
| InChI | InChI=1S/C51H39N3/c1-32(34-15-7-5-8-16-34)27-48(35-17-9-6-10-18-35)52-33(2)54-49-22-14-12-20-39(49)43-30-41-40-28-36(23-25-44(40)51(3,4)45(41)31-50(43)54)37-24-26-47-42(29-37)38-19-11-13-21-46(38)53-47/h5-31,53H,2H2,1,3-4H3/b32-27+,52-48+ |
| InChIKey | MIOBHDBULOVJLQ-JSINWUGVSA-N |
| XLogP | 13.42 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|