C44H37N — CID 145017127
5-[(3E)-4-(3,5-diphenylphenyl)penta-1,3-dien-2-yl]-7,7-dimethyl-9,10-dihydroindeno[2,1-b]carbazole (PubChem CID 145017127) has the molecular formula C44H37N and a molecular weight of 579.79 g/mol. Its IUPAC name is 5-[(3E)-4-(3,5-diphenylphenyl)penta-1,3-dien-2-yl]-7,7-dimethyl-9,10-dihydroindeno[2,1-b]carbazole.
| Compound Name | 5-[(3E)-4-(3,5-diphenylphenyl)penta-1,3-dien-2-yl]-7,7-dimethyl-9,10-dihydroindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 145017127 |
| Molecular Formula | C44H37N |
| Molecular Weight | 579.79 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 5-[(3E)-4-(3,5-diphenylphenyl)penta-1,3-dien-2-yl]-7,7-dimethyl-9,10-dihydroindeno[2,1-b]carbazole |
| SMILES | C=C(/C=C(\C)c1cc(-c2ccccc2)cc(-c2ccccc2)c1)n1c2ccccc2c2cc3c(cc21)C(C)(C)C1=CCCC=C13 |
| InChI | InChI=1S/C44H37N/c1-29(33-24-34(31-15-7-5-8-16-31)26-35(25-33)32-17-9-6-10-18-32)23-30(2)45-42-22-14-12-20-37(42)39-27-38-36-19-11-13-21-40(36)44(3,4)41(38)28-43(39)45/h5-10,12,14-28H,2,11,13H2,1,3-4H3/b29-23+ |
| InChIKey | BJPIZCUJCOYRJP-BYNJWEBRSA-N |
| XLogP | 12.10 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.79 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|