C38H31N3 — CID 154035967
7,7-dimethyl-N'-(1-phenylethenyl)-N-(1-phenylethylidene)indeno[2,1-b]carbazole-5-carboximidamide (PubChem CID 154035967) has the molecular formula C38H31N3 and a molecular weight of 529.69 g/mol. Its IUPAC name is 7,7-dimethyl-N'-(1-phenylethenyl)-N-(1-phenylethylidene)indeno[2,1-b]carbazole-5-carboximidamide.
| Compound Name | 7,7-dimethyl-N'-(1-phenylethenyl)-N-(1-phenylethylidene)indeno[2,1-b]carbazole-5-carboximidamide |
|---|---|
| PubChem CID | 154035967 |
| Molecular Formula | C38H31N3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 7,7-dimethyl-N'-(1-phenylethenyl)-N-(1-phenylethylidene)indeno[2,1-b]carbazole-5-carboximidamide |
| SMILES | C=C(/N=C(\N=C(C)c1ccccc1)n1c2ccccc2c2cc3c(cc21)C(C)(C)c1ccccc1-3)c1ccccc1 |
| InChI | InChI=1S/C38H31N3/c1-25(27-15-7-5-8-16-27)39-37(40-26(2)28-17-9-6-10-18-28)41-35-22-14-12-20-30(35)32-23-31-29-19-11-13-21-33(29)38(3,4)34(31)24-36(32)41/h5-24H,1H2,2-4H3/b39-37+,40-26? |
| InChIKey | SBXIJONZAHCPHS-GDQJYIEWSA-N |
| XLogP | 9.48 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|