C48H40N2 — CID 144564945
N-[(1Z)-1-(9,9-dimethylfluoren-2-yl)-3-phenylbuta-1,3-dienyl]-1-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)ethanimine (PubChem CID 144564945) has the molecular formula C48H40N2 and a molecular weight of 644.86 g/mol. Its IUPAC name is N-[(1Z)-1-(9,9-dimethylfluoren-2-yl)-3-phenylbuta-1,3-dienyl]-1-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)ethanimine.
| Compound Name | N-[(1Z)-1-(9,9-dimethylfluoren-2-yl)-3-phenylbuta-1,3-dienyl]-1-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)ethanimine |
|---|---|
| PubChem CID | 144564945 |
| Molecular Formula | C48H40N2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | N-[(1Z)-1-(9,9-dimethylfluoren-2-yl)-3-phenylbuta-1,3-dienyl]-1-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)ethanimine |
| SMILES | C=C(/C=C(\N=C(/C)n1c2ccccc2c2cc3c(cc21)-c1ccccc1C3(C)C)c1ccc2c(c1)C(C)(C)c1ccccc1-2)c1ccccc1 |
| InChI | InChI=1S/C48H40N2/c1-30(32-16-8-7-9-17-32)26-44(33-24-25-36-34-18-10-13-21-40(34)47(3,4)42(36)27-33)49-31(2)50-45-23-15-12-20-37(45)39-28-43-38(29-46(39)50)35-19-11-14-22-41(35)48(43,5)6/h7-29H,1H2,2-6H3/b44-26-,49-31+ |
| InChIKey | XTJRWRGTVOVBEG-IKEOZRRCSA-N |
| XLogP | 12.43 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|