C50H40N4 — CID 88914189
4-(21,21-dimethyl-14-phenyl-10,14-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-10-yl)-N'-[(1Z)-1,3-diphenylbuta-1,3-dienyl]benzenecarboximidamide (PubChem CID 88914189) has the molecular formula C50H40N4 and a molecular weight of 696.90 g/mol. Its IUPAC name is 4-(21,21-dimethyl-14-phenyl-10,14-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-10-yl)-N'-[(1Z)-1,3-diphenylbuta-1,3-dienyl]benzenecarboximidamide.
| Compound Name | 4-(21,21-dimethyl-14-phenyl-10,14-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-10-yl)-N'-[(1Z)-1,3-diphenylbuta-1,3-dienyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 88914189 |
| Molecular Formula | C50H40N4 |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | 4-(21,21-dimethyl-14-phenyl-10,14-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-10-yl)-N'-[(1Z)-1,3-diphenylbuta-1,3-dienyl]benzenecarboximidamide |
| SMILES | C=C(/C=C(\N=C(/N)c1ccc(-n2c3ccccc3c3cc4c(cc32)N(c2ccccc2)c2ccccc2C4(C)C)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H40N4/c1-34(35-17-7-4-8-18-35)31-44(36-19-9-5-10-20-36)52-49(51)37-27-29-39(30-28-37)53-45-25-15-13-23-40(45)41-32-43-48(33-47(41)53)54(38-21-11-6-12-22-38)46-26-16-14-24-42(46)50(43,2)3/h4-33H,1H2,2-3H3,(H2,51,52)/b44-31- |
| InChIKey | CNGUWDJNQQGJRY-JUYRPGCLSA-N |
| XLogP | 12.35 |
| TPSA | 46.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.90 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|